cas: 886496-88-4 — see every product listed under this CAS number, including other names
3-Bromo-4-(trifluoromethoxy)phenol, 95% (CAS 886496-88-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021863-250MG |
| cas | 886496-88-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 549.82 Pln | |
| Fluorochem | 10g | 1049.65 Pln | |
| Fluorochem | 25g | 2528.29 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-bromo-4-(trifluoromethoxy)phenol (CAS 886496-88-4) is a chemical compound with the molecular formula C7H4BrF3O2 and a molecular weight of 257.00 g/mol. IUPAC name: 3-bromo-4-(trifluoromethoxy)phenol. InChIKey: GVPNWQKCKBFPBG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O2 |
|---|---|
| Molecular weight | 257.00 g/mol |
| IUPAC name | 3-bromo-4-(trifluoromethoxy)phenol |
| InChIKey | GVPNWQKCKBFPBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Br)OC(F)(F)F |
Computed by PubChem (NCBI)