cas: 885521-40-4 — see every product listed under this CAS number, including other names
3-Bromo-4-chloro-1H-indazole, 97% (CAS 885521-40-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A785524-100mg |
| cas | 885521-40-4 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 747.04 Pln | |
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 500mg | 653.95 Pln | |
| Fluorochem | 1g | 1174.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-4-chloro-2H-indazole (CAS 885521-40-4) is a chemical compound with the molecular formula C7H4BrClN2 and a molecular weight of 231.48 g/mol. IUPAC name: 3-bromo-4-chloro-2H-indazole. InChIKey: KQVVWXSIPZGIAN-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2 |
|---|---|
| Molecular weight | 231.48 g/mol |
| IUPAC name | 3-bromo-4-chloro-2H-indazole |
| InChIKey | KQVVWXSIPZGIAN-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C(=C1)Cl)Br |
Computed by PubChem (NCBI)