cas: 2757551-02-1 — see every product listed under this CAS number, including other names
3-Bromo-4-chloro-5-nitro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 97% (CAS 2757551-02-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F761337-100MG |
| cas | 2757551-02-1 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 700.81 Pln | |
| Fluorochem | 250mg | 1112.13 Pln | |
| Fluorochem | 500mg | 1794.18 Pln | |
| Fluorochem | 1g | 2648.04 Pln | |
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 500mg | 923.60 Pln | |
| Chemat | 1g | 1350.80 Pln | |
| Chemat | 5g | 3933.20 Pln | |
| Chemat | 10g | 6515.60 Pln | |
| Chemat | 25g | 12971.60 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1-(benzenesulfonyl)-3-bromo-4-chloro-5-nitropyrrolo[2,3-b]pyridine (CAS 2757551-02-1) is a chemical compound with the molecular formula C13H7BrClN3O4S and a molecular weight of 416.63 g/mol. IUPAC name: 1-(benzenesulfonyl)-3-bromo-4-chloro-5-nitropyrrolo[2,3-b]pyridine. InChIKey: HDUMQYIHEWMGPY-UHFFFAOYSA-N.
| Molecular formula | C13H7BrClN3O4S |
|---|---|
| Molecular weight | 416.63 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-3-bromo-4-chloro-5-nitropyrrolo[2,3-b]pyridine |
| InChIKey | HDUMQYIHEWMGPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C(C(=CN=C32)[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)