cas: 1204810-99-0 — see every product listed under this CAS number, including other names
3-Bromo-4-chloro-6-(trifluoromethyl)quinoline, 95+%, 95+% (CAS 1204810-99-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11046M-100mg |
| cas | 1204810-99-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 246.80 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4-chloro-6-(trifluoromethyl)quinoline (CAS 1204810-99-0) is a chemical compound with the molecular formula C10H4BrClF3N and a molecular weight of 310.50 g/mol. IUPAC name: 3-bromo-4-chloro-6-(trifluoromethyl)quinoline. InChIKey: BNOPQFZALQIKEY-UHFFFAOYSA-N.
| Molecular formula | C10H4BrClF3N |
|---|---|
| Molecular weight | 310.50 g/mol |
| IUPAC name | 3-bromo-4-chloro-6-(trifluoromethyl)quinoline |
| InChIKey | BNOPQFZALQIKEY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C=C1C(F)(F)F)Cl)Br |
Computed by PubChem (NCBI)