cas: 1345471-86-4 — see every product listed under this CAS number, including other names
3-Bromo-4-fluoro-5-nitrobenzamide, 98%, 98% (CAS 1345471-86-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110WLO-100mg |
| cas | 1345471-86-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 957.20 Pln | |
| Chemat | 5g | 3506.00 Pln | |
| Chemat | 10g | 5920.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4-fluoro-5-nitrobenzamide (CAS 1345471-86-4) is a chemical compound with the molecular formula C7H4BrFN2O3 and a molecular weight of 263.02 g/mol. IUPAC name: 3-bromo-4-fluoro-5-nitrobenzamide. InChIKey: ZZLBLAZKHBROQT-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2O3 |
|---|---|
| Molecular weight | 263.02 g/mol |
| IUPAC name | 3-bromo-4-fluoro-5-nitrobenzamide |
| InChIKey | ZZLBLAZKHBROQT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)Br)C(=O)N |
Computed by PubChem (NCBI)