cas: 210824-69-4 — see every product listed under this CAS number, including other names
3-Bromo-4-methylbenzenesulfonamide 98% (CAS 210824-69-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A272502-250mg |
| cas | 210824-69-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Ambeed | 25g | 5131.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A272502 |
3-bromo-4-methylbenzenesulfonamide (CAS 210824-69-4) is a chemical compound with the molecular formula C7H8BrNO2S and a molecular weight of 250.12 g/mol. IUPAC name: 3-bromo-4-methylbenzenesulfonamide. InChIKey: CFMBNGJNYNLPDL-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO2S |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | 3-bromo-4-methylbenzenesulfonamide |
| InChIKey | CFMBNGJNYNLPDL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)N)Br |
Computed by PubChem (NCBI)