cas: 1057338-30-3 — see every product listed under this CAS number, including other names
3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine dihydrochloride (CAS 1057338-30-3) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1103H5-5mg |
| cas | 1057338-30-3 |
| size | 5mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 194.00 Pln | |
| Chemat | 25mg | 352.40 Pln |
| delivery time | 3 weeks |
|---|
3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine;dihydrochloride (CAS 1057338-30-3) is a chemical compound with the molecular formula C6H10BrCl2N3 and a molecular weight of 274.97 g/mol. IUPAC name: 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine;dihydrochloride. InChIKey: RZJOUGGNBAYGEB-UHFFFAOYSA-N.
| Molecular formula | C6H10BrCl2N3 |
|---|---|
| Molecular weight | 274.97 g/mol |
| IUPAC name | 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine;dihydrochloride |
| InChIKey | RZJOUGGNBAYGEB-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NC=C2Br)CN1.Cl.Cl |
Computed by PubChem (NCBI)