cas: 445491-71-4 — see every product listed under this CAS number, including other names
3-Bromo-5-(methylsulfonyl)pyridine 95% (CAS 445491-71-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A781142-250mg |
| cas | 445491-71-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 681.88 Pln | |
| Ambeed | 25g | 1911.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A781142 |
3-bromo-5-methylsulfonylpyridine (CAS 445491-71-4) is a chemical compound with the molecular formula C6H6BrNO2S and a molecular weight of 236.09 g/mol. IUPAC name: 3-bromo-5-methylsulfonylpyridine. InChIKey: CNAIMMQZMLBREW-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO2S |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 3-bromo-5-methylsulfonylpyridine |
| InChIKey | CNAIMMQZMLBREW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)