cas: 203806-50-2 — see every product listed under this CAS number, including other names
3-Bromo-5-(tert-butyl)-[1,1'-biphenyl]-2-amine, 95%, 95% (CAS 203806-50-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1359QS-250mg |
| cas | 203806-50-2 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-4-tert-butyl-6-phenylaniline (CAS 203806-50-2) is a chemical compound with the molecular formula C16H18BrN and a molecular weight of 304.22 g/mol. IUPAC name: 2-bromo-4-tert-butyl-6-phenylaniline. InChIKey: VPFGSFWZJTVBFT-UHFFFAOYSA-N.
| Molecular formula | C16H18BrN |
|---|---|
| Molecular weight | 304.22 g/mol |
| IUPAC name | 2-bromo-4-tert-butyl-6-phenylaniline |
| InChIKey | VPFGSFWZJTVBFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)Br)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)