cas: 1197239-47-6 — see every product listed under this CAS number, including other names
3-Bromo-5-(trifluoromethoxy)phenol, 97%, 97% (CAS 1197239-47-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PK6-5g |
| cas | 1197239-47-6 |
| size | 5g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 2056.40 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 813.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5-(trifluoromethoxy)phenol (CAS 1197239-47-6) is a chemical compound with the molecular formula C7H4BrF3O2 and a molecular weight of 257.00 g/mol. IUPAC name: 3-bromo-5-(trifluoromethoxy)phenol. InChIKey: LWPUQZXDLKIRAX-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O2 |
|---|---|
| Molecular weight | 257.00 g/mol |
| IUPAC name | 3-bromo-5-(trifluoromethoxy)phenol |
| InChIKey | LWPUQZXDLKIRAX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Br)O |
Computed by PubChem (NCBI)