cas: 866546-10-3 — see every product listed under this CAS number, including other names
3-Bromo-5-chloro-1-[(4-methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridine, 97%, 97% (CAS 866546-10-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IE6X-250mg |
| cas | 866546-10-3 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 500mg | 270.80 Pln | |
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 986.00 Pln | |
| Chemat | 10g | 1605.20 Pln | |
| Chemat | 25g | 3141.20 Pln | |
| Chemat | 100g | 8070.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (CAS 866546-10-3) is a chemical compound with the molecular formula C14H10BrClN2O2S and a molecular weight of 385.7 g/mol. IUPAC name: 3-bromo-5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine. InChIKey: NTOWWABYYWPKKJ-UHFFFAOYSA-N.
| Molecular formula | C14H10BrClN2O2S |
|---|---|
| Molecular weight | 385.7 g/mol |
| IUPAC name | 3-bromo-5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| InChIKey | NTOWWABYYWPKKJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C2N=CC(=C3)Cl)Br |
Computed by PubChem (NCBI)