cas: 245325-30-8 — see every product listed under this CAS number, including other names
3-Bromo-5-chloro-1H-pyrazolo[3,4-c]pyridine 97% (CAS 245325-30-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A609916-100mg |
| cas | 245325-30-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 820.94 Pln | |
| Ambeed | 5g | 2289.44 Pln | |
| Ambeed | 10g | 3813.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A609916 |
3-bromo-5-chloro-2H-pyrazolo[3,4-c]pyridine (CAS 245325-30-8) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 3-bromo-5-chloro-2H-pyrazolo[3,4-c]pyridine. InChIKey: OIWHFIVQONMGEC-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 3-bromo-5-chloro-2H-pyrazolo[3,4-c]pyridine |
| InChIKey | OIWHFIVQONMGEC-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC2=NNC(=C21)Br)Cl |
Computed by PubChem (NCBI)