cas: 1352892-94-4 — see every product listed under this CAS number, including other names
3-Bromo-5-chloro-1H-pyrazolo[4,3-b]pyridine 95% (CAS 1352892-94-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A140721-100mg |
| cas | 1352892-94-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 392.62 Pln | |
| Ambeed | 1g | 1093.50 Pln | |
| Ambeed | 5g | 3969.31 Pln | |
| Ambeed | 10g | 6305.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A140721 |
3-bromo-5-chloro-2H-pyrazolo[4,3-b]pyridine (CAS 1352892-94-4) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 3-bromo-5-chloro-2H-pyrazolo[4,3-b]pyridine. InChIKey: RBKKRSSXOLSAOP-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 3-bromo-5-chloro-2H-pyrazolo[4,3-b]pyridine |
| InChIKey | RBKKRSSXOLSAOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C(NN=C21)Br)Cl |
Computed by PubChem (NCBI)