cas: 887338-48-9 — see every product listed under this CAS number, including other names
3-Bromo-5-fluoro-1-(p-toluenesulfonyl)indole, ≥98%, ≥98% (CAS 887338-48-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J3S-100mg |
| cas | 887338-48-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 333.20 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 942.80 Pln | |
| Chemat | 10g | 3851.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5-fluoro-1-(4-methylphenyl)sulfonylindole (CAS 887338-48-9) is a chemical compound with the molecular formula C15H11BrFNO2S and a molecular weight of 368.2 g/mol. IUPAC name: 3-bromo-5-fluoro-1-(4-methylphenyl)sulfonylindole. InChIKey: GUWFEADJNZQXFC-UHFFFAOYSA-N.
| Molecular formula | C15H11BrFNO2S |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | 3-bromo-5-fluoro-1-(4-methylphenyl)sulfonylindole |
| InChIKey | GUWFEADJNZQXFC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C2C=CC(=C3)F)Br |
Computed by PubChem (NCBI)