cas: 914349-24-9 — see every product listed under this CAS number, including other names
3-Bromo-5-methyl-1H-indole, N-BOC protected, >95%, >95% (CAS 914349-24-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGOL-100mg |
| cas | 914349-24-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2234.00 Pln | |
| Chemat | 250mg | 3472.40 Pln | |
| Chemat | 1g | 8435.60 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-bromo-5-methylindole-1-carboxylate (CAS 914349-24-9) is a chemical compound with the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. IUPAC name: tert-butyl 3-bromo-5-methylindole-1-carboxylate. InChIKey: OZMQFZLYHMJMSA-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO2 |
|---|---|
| Molecular weight | 310.19 g/mol |
| IUPAC name | tert-butyl 3-bromo-5-methylindole-1-carboxylate |
| InChIKey | OZMQFZLYHMJMSA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C=C2Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)