cas: 887338-51-4 — see every product listed under this CAS number, including other names
3-Bromo-6-fluoro-1-(p-toluenesulfonyl)indole, 97%, 97% (CAS 887338-51-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J4K-250mg |
| cas | 887338-51-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 333.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-6-fluoro-1-(4-methylphenyl)sulfonylindole (CAS 887338-51-4) is a chemical compound with the molecular formula C15H11BrFNO2S and a molecular weight of 368.2 g/mol. IUPAC name: 3-bromo-6-fluoro-1-(4-methylphenyl)sulfonylindole. InChIKey: FELXKTSAXVBKCL-UHFFFAOYSA-N.
| Molecular formula | C15H11BrFNO2S |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | 3-bromo-6-fluoro-1-(4-methylphenyl)sulfonylindole |
| InChIKey | FELXKTSAXVBKCL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C2C=C(C=C3)F)Br |
Computed by PubChem (NCBI)