cas: 1190317-52-2 — see every product listed under this CAS number, including other names
3-Bromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine, 95%, 95% (CAS 1190317-52-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111P63-100mg |
| cas | 1190317-52-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 683.60 Pln | |
| Chemat | 250mg | 1370.00 Pln | |
| Chemat | 1g | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine (CAS 1190317-52-2) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 3-bromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine. InChIKey: ISENGFMRAAURKN-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 3-bromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | ISENGFMRAAURKN-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)C(=CN2)Br |
Computed by PubChem (NCBI)