cas: 150935-62-9 — see every product listed under this CAS number, including other names
3-Bromo-6-methyl-5-nitropyridin-2-amine, 95%, 95% (CAS 150935-62-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118X9F-100mg |
| cas | 150935-62-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Chemat | 5g | 3424.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-6-methyl-5-nitropyridin-2-amine (CAS 150935-62-9) is a chemical compound with the molecular formula C6H6BrN3O2 and a molecular weight of 232.03 g/mol. IUPAC name: 3-bromo-6-methyl-5-nitropyridin-2-amine. InChIKey: QEACSSLDLWHNGC-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN3O2 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 3-bromo-6-methyl-5-nitropyridin-2-amine |
| InChIKey | QEACSSLDLWHNGC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1[N+](=O)[O-])Br)N |
Computed by PubChem (NCBI)