cas: 1065087-83-3 — see every product listed under this CAS number, including other names
3-Bromo-8-fluoroquinolin-4(1H)-one, 95% (CAS 1065087-83-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F756241-100MG |
| cas | 1065087-83-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 825.77 Pln | |
| Fluorochem | 250mg | 1356.83 Pln | |
| Fluorochem | 1g | 3543.56 Pln | |
| Fluorochem | 5g | 8885.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-8-fluoro-1H-quinolin-4-one (CAS 1065087-83-3) is a chemical compound with the molecular formula C9H5BrFNO and a molecular weight of 242.04 g/mol. IUPAC name: 3-bromo-8-fluoro-1H-quinolin-4-one. InChIKey: PXKSZDKDNPVFPM-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | 3-bromo-8-fluoro-1H-quinolin-4-one |
| InChIKey | PXKSZDKDNPVFPM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)NC=C(C2=O)Br |
Computed by PubChem (NCBI)