CAS 2380273-78-7 is the registry number for 3-Bromo-N-(2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)propanamide, 99%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanamide (CAS 2380273-78-7) is a chemical compound with the molecular formula C16H14BrN3O5 and a molecular weight of 408.20 g/mol. IUPAC name: 3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanamide. InChIKey: CCIKLKZDGKZXEQ-UHFFFAOYSA-N.
| Molecular formula | C16H14BrN3O5 |
|---|---|
| Molecular weight | 408.20 g/mol |
| IUPAC name | 3-bromo-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanamide |
| InChIKey | CCIKLKZDGKZXEQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NC(=O)CCBr |
Computed by PubChem (NCBI)