cas: 10135-00-9 — see every product listed under this CAS number, including other names
3-Bromobenzo[b]thiophene-2-carbaldehyde 95% (CAS 10135-00-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A373026-100mg |
| cas | 10135-00-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 598.44 Pln | |
| Ambeed | 5g | 2050.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A373026 |
3-bromo-1-benzothiophene-2-carbaldehyde (CAS 10135-00-9) is a chemical compound with the molecular formula C9H5BrOS and a molecular weight of 241.11 g/mol. IUPAC name: 3-bromo-1-benzothiophene-2-carbaldehyde. InChIKey: GQUZXULTSUGIRF-UHFFFAOYSA-N.
| Molecular formula | C9H5BrOS |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 3-bromo-1-benzothiophene-2-carbaldehyde |
| InChIKey | GQUZXULTSUGIRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)C=O)Br |
Computed by PubChem (NCBI)