cas: 919354-04-4 — see every product listed under this CAS number, including other names
3-Bromobenzylsulfonamide, 98% (CAS 919354-04-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044462-100MG |
| cas | 919354-04-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1158.98 Pln | |
| Fluorochem | 5g | 3637.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3-bromophenyl)methanesulfonamide (CAS 919354-04-4) is a chemical compound with the molecular formula C7H8BrNO2S and a molecular weight of 250.12 g/mol. IUPAC name: (3-bromophenyl)methanesulfonamide. InChIKey: NZPHFPJATRGGMD-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO2S |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | (3-bromophenyl)methanesulfonamide |
| InChIKey | NZPHFPJATRGGMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CS(=O)(=O)N |
Computed by PubChem (NCBI)