CAS 98278-78-5 appears in our catalog under these names: 5-Bromo-2,3-pyridinedicarboxylic anhydride, 98%, 3-Bromofuro(3,4-b)pyridine-5,7-dione, 3-bromofuro[3,4-b]pyridine-5,7-dione, 96%, 96%, 3-Bromofuro[3,4-b]pyridine-5,7-dione, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 250mg, 1g, 100mg, 500mg.
3-bromofuro[3,4-b]pyridine-5,7-dione (CAS 98278-78-5) is a chemical compound with the molecular formula C7H2BrNO3 and a molecular weight of 228.00 g/mol. IUPAC name: 3-bromofuro[3,4-b]pyridine-5,7-dione. InChIKey: FMIBWNJUQJRTER-UHFFFAOYSA-N.
| Molecular formula | C7H2BrNO3 |
|---|---|
| Molecular weight | 228.00 g/mol |
| IUPAC name | 3-bromofuro[3,4-b]pyridine-5,7-dione |
| InChIKey | FMIBWNJUQJRTER-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=O)OC2=O)Br |
Computed by PubChem (NCBI)