cas: 242459-81-0 — see every product listed under this CAS number, including other names
3-Bromomethyl-piperidine-1-carboxylic acid benzyl ester (CAS 242459-81-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F087377-250MG |
| cas | 242459-81-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 820.56 Pln | |
| Fluorochem | 1g | 1185.02 Pln | |
| Fluorochem | 5g | 3887.19 Pln |
| delivery time | 3-4 weeks |
|---|
Benzyl 3-(bromomethyl)piperidine-1-carboxylate (CAS 242459-81-0) is a chemical compound with the molecular formula C14H18BrNO2 and a molecular weight of 312.20 g/mol. IUPAC name: benzyl 3-(bromomethyl)piperidine-1-carboxylate. InChIKey: YXSCVZBVAAVNKV-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO2 |
|---|---|
| Molecular weight | 312.20 g/mol |
| IUPAC name | benzyl 3-(bromomethyl)piperidine-1-carboxylate |
| InChIKey | YXSCVZBVAAVNKV-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)OCC2=CC=CC=C2)CBr |
Computed by PubChem (NCBI)