cas: 914225-55-1 — see every product listed under this CAS number, including other names
3-CHLORO-2-FLUORO-5-NITROBENZOTRIFLUORIDE, 97%, 97% (CAS 914225-55-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GRPE-250mg |
| cas | 914225-55-1 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 496.40 Pln | |
| Chemat | 25g | 2186.00 Pln | |
| Chemat | 100mg | 78.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-chloro-2-fluoro-5-nitro-3-(trifluoromethyl)benzene (CAS 914225-55-1) is a chemical compound with the molecular formula C7H2ClF4NO2 and a molecular weight of 243.54 g/mol. IUPAC name: 1-chloro-2-fluoro-5-nitro-3-(trifluoromethyl)benzene. InChIKey: DXSHRLNTFMMNIQ-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF4NO2 |
|---|---|
| Molecular weight | 243.54 g/mol |
| IUPAC name | 1-chloro-2-fluoro-5-nitro-3-(trifluoromethyl)benzene |
| InChIKey | DXSHRLNTFMMNIQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)