CAS 1835-61-6 appears in our catalog under these names: 1-Chloro-2,3,5,6-tetrafluorobenzene, 98%, 3-Chloro-1,2,4,5-tetrafluorobenzene 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 25g, 1g, 5g.
3-chloro-1,2,4,5-tetrafluorobenzene (CAS 1835-61-6) is a chemical compound with the molecular formula C6HClF4 and a molecular weight of 184.52 g/mol. IUPAC name: 3-chloro-1,2,4,5-tetrafluorobenzene. InChIKey: QLDHPPIOYFTGAJ-UHFFFAOYSA-N.
| Molecular formula | C6HClF4 |
|---|---|
| Molecular weight | 184.52 g/mol |
| IUPAC name | 3-chloro-1,2,4,5-tetrafluorobenzene |
| InChIKey | QLDHPPIOYFTGAJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Cl)F)F |
Computed by PubChem (NCBI)