3-Chloro-2-aminobenzamide, 95%
cas: 18343-44-7 — see every product listed under this CAS number, including other names
3-Chloro-2-aminobenzamide, 95% (CAS 18343-44-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A279093-250mg |
| cas | 18343-44-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 759.75 Pln | |
| Ambeed | 5g | 2584.25 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 942.80 Pln | |
| Chemat | 5g | 2805.20 Pln | |
| BLDpharm | 100mg | 258.82 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 814.18 Pln | |
| BLDpharm | 5g | 2780.16 Pln | |
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 700.81 Pln | |
| Fluorochem | 1g | 1736.91 Pln | |
| Fluorochem | 5g | 5204.44 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-3-chlorobenzamide (CAS 18343-44-7) is a chemical compound with the molecular formula C7H7ClN2O and a molecular weight of 170.59 g/mol. IUPAC name: 2-amino-3-chlorobenzamide. InChIKey: BINWIYVHWRWUSD-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O |
|---|---|
| Molecular weight | 170.59 g/mol |
| IUPAC name | 2-amino-3-chlorobenzamide |
| InChIKey | BINWIYVHWRWUSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N)C(=O)N |
Computed by PubChem (NCBI)