cas: 1135283-18-9 — see every product listed under this CAS number, including other names
3-Chloro-2-ethynyl-5-(trifluoromethyl)pyridine 98% (CAS 1135283-18-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A402780-100mg |
| cas | 1135283-18-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 921.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A402780 |
3-chloro-2-ethynyl-5-(trifluoromethyl)pyridine (CAS 1135283-18-9) is a chemical compound with the molecular formula C8H3ClF3N and a molecular weight of 205.56 g/mol. IUPAC name: 3-chloro-2-ethynyl-5-(trifluoromethyl)pyridine. InChIKey: MGBAONQLGHVNRS-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3N |
|---|---|
| Molecular weight | 205.56 g/mol |
| IUPAC name | 3-chloro-2-ethynyl-5-(trifluoromethyl)pyridine |
| InChIKey | MGBAONQLGHVNRS-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C=C(C=N1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)