cas: 51984-62-4 — see every product listed under this CAS number, including other names
3-Chloro-2-methyl-5-nitropyridine, 98%, 98% (CAS 51984-62-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0AS-250mg |
| cas | 51984-62-4 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 10g | 534.80 Pln | |
| Chemat | 25g | 1067.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-chloro-2-methyl-5-nitropyridine (CAS 51984-62-4) is a chemical compound with the molecular formula C6H5ClN2O2 and a molecular weight of 172.57 g/mol. IUPAC name: 3-chloro-2-methyl-5-nitropyridine. InChIKey: KEQYIUZGVFBSNL-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2 |
|---|---|
| Molecular weight | 172.57 g/mol |
| IUPAC name | 3-chloro-2-methyl-5-nitropyridine |
| InChIKey | KEQYIUZGVFBSNL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)