cas: 2096337-95-8 — see every product listed under this CAS number, including other names
3-Chloro-4-(pyrrolidinomethyl)phenylboronic acid, pinacol ester, 97%, 97% (CAS 2096337-95-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHN2-250mg |
| cas | 2096337-95-8 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 674.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine (CAS 2096337-95-8) is a chemical compound with the molecular formula C17H25BClNO2 and a molecular weight of 321.7 g/mol. IUPAC name: 1-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine. InChIKey: HDTOISQUJFQIDK-UHFFFAOYSA-N.
| Molecular formula | C17H25BClNO2 |
|---|---|
| Molecular weight | 321.7 g/mol |
| IUPAC name | 1-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine |
| InChIKey | HDTOISQUJFQIDK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CN3CCCC3)Cl |
Computed by PubChem (NCBI)