cas: 2034154-09-9 — see every product listed under this CAS number, including other names
3-Chloro-5,6,7,8-tetrahydroimidazo(1,2-a)pyrazine hydrochloride, 97% (CAS 2034154-09-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1178495-5g |
| cas | 2034154-09-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 30706.06 Pln | |
| AmBeed | 10g | 42977.41 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine;dihydrochloride (CAS 2034154-09-9) is a chemical compound with the molecular formula C6H10Cl3N3 and a molecular weight of 230.5 g/mol. IUPAC name: 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine;dihydrochloride. InChIKey: AWFKNKRZRLLHPH-UHFFFAOYSA-N.
| Molecular formula | C6H10Cl3N3 |
|---|---|
| Molecular weight | 230.5 g/mol |
| IUPAC name | 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine;dihydrochloride |
| InChIKey | AWFKNKRZRLLHPH-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NC=C2Cl)CN1.Cl.Cl |
Computed by PubChem (NCBI)