cas: 1212021-11-8 — see every product listed under this CAS number, including other names
3-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile 98% (CAS 1212021-11-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A164639-100mg |
| cas | 1212021-11-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 2083.62 Pln | |
| Ambeed | 25g | 8714.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A164639 |
3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1212021-11-8) is a chemical compound with the molecular formula C13H15BClNO2 and a molecular weight of 263.53 g/mol. IUPAC name: 3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: AAZQJHZPPYLORA-UHFFFAOYSA-N.
| Molecular formula | C13H15BClNO2 |
|---|---|
| Molecular weight | 263.53 g/mol |
| IUPAC name | 3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | AAZQJHZPPYLORA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)C#N |
Computed by PubChem (NCBI)