cas: 13852-53-4 — see every product listed under this CAS number, including other names
3-Chloro-6-methyl-2-nitroaniline, 98% (CAS 13852-53-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A647917-5g |
| cas | 13852-53-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14626.36 Pln | |
| Fluorochem | 100mg | 690.40 Pln | |
| Fluorochem | 250mg | 1263.11 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-chloro-6-methyl-2-nitroaniline (CAS 13852-53-4) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 3-chloro-6-methyl-2-nitroaniline. InChIKey: DKUCSJAKXOTDCM-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 3-chloro-6-methyl-2-nitroaniline |
| InChIKey | DKUCSJAKXOTDCM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)[N+](=O)[O-])N |
Computed by PubChem (NCBI)