cas: 22179-77-7 — see every product listed under this CAS number, including other names
3-Chlorobenzamide oxime (CAS 22179-77-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040282-1G |
| cas | 22179-77-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1549.47 Pln |
| delivery time | 2-3 weeks |
|---|
3-chloro-N'-hydroxybenzenecarboximidamide (CAS 22179-77-7) is a chemical compound with the molecular formula C7H7ClN2O and a molecular weight of 170.59 g/mol. IUPAC name: 3-chloro-N'-hydroxybenzenecarboximidamide. InChIKey: WYAJMVHDMUWQQA-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O |
|---|---|
| Molecular weight | 170.59 g/mol |
| IUPAC name | 3-chloro-N'-hydroxybenzenecarboximidamide |
| InChIKey | WYAJMVHDMUWQQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)/C(=N/O)/N |
Computed by PubChem (NCBI)