cas: 1179360-43-0 — see every product listed under this CAS number, including other names
3-Chloropicolinimidamide hydrochloride 97% (CAS 1179360-43-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A286958-250mg |
| cas | 1179360-43-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 442.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A286958 |
3-chloropyridine-2-carboximidamide;hydrochloride (CAS 1179360-43-0) is a chemical compound with the molecular formula C6H7Cl2N3 and a molecular weight of 192.04 g/mol. IUPAC name: 3-chloropyridine-2-carboximidamide;hydrochloride. InChIKey: OHCTVSVXORSCHH-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl2N3 |
|---|---|
| Molecular weight | 192.04 g/mol |
| IUPAC name | 3-chloropyridine-2-carboximidamide;hydrochloride |
| InChIKey | OHCTVSVXORSCHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=N)N)Cl.Cl |
Computed by PubChem (NCBI)