cas: 479636-65-2 — see every product listed under this CAS number, including other names
3-ETHYL 8-BOC-1-OXA-2,8-DIAZASPIRO[4.5]DEC-2-ENE-3-CARBOXYLATE, 98% (CAS 479636-65-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387874-100MG |
| cas | 479636-65-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 981.96 Pln | |
| Fluorochem | 5g | 3278.03 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
8-O-tert-butyl 3-O-ethyl 1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3,8-dicarboxylate (CAS 479636-65-2) is a chemical compound with the molecular formula C15H24N2O5 and a molecular weight of 312.36 g/mol. IUPAC name: 8-O-tert-butyl 3-O-ethyl 1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3,8-dicarboxylate. InChIKey: REZWEKFBSWCVEQ-UHFFFAOYSA-N.
| Molecular formula | C15H24N2O5 |
|---|---|
| Molecular weight | 312.36 g/mol |
| IUPAC name | 8-O-tert-butyl 3-O-ethyl 1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3,8-dicarboxylate |
| InChIKey | REZWEKFBSWCVEQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC2(C1)CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)