cas: 846038-33-3 — see every product listed under this CAS number, including other names
3-FLUOROQUINOLIN-8-AMINE, 97% (CAS 846038-33-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386272-250MG |
| cas | 846038-33-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 2090.95 Pln | |
| Fluorochem | 100mg | 1096.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-fluoroquinolin-8-amine (CAS 846038-33-3) is a chemical compound with the molecular formula C9H7FN2 and a molecular weight of 162.16 g/mol. IUPAC name: 3-fluoroquinolin-8-amine. InChIKey: PPNJCBCQJOATIU-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2 |
|---|---|
| Molecular weight | 162.16 g/mol |
| IUPAC name | 3-fluoroquinolin-8-amine |
| InChIKey | PPNJCBCQJOATIU-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)N)F |
Computed by PubChem (NCBI)