cas: 503177-15-9 — see every product listed under this CAS number, including other names
3-Fluoro-[1,1'-biphenyl]-4-carbonitrile 95% (CAS 503177-15-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A568747-250mg |
| cas | 503177-15-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1727.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A568747 |
2-fluoro-4-phenylbenzonitrile (CAS 503177-15-9) is a chemical compound with the molecular formula C13H8FN and a molecular weight of 197.21 g/mol. IUPAC name: 2-fluoro-4-phenylbenzonitrile. InChIKey: GORYKZHNAWEFBP-UHFFFAOYSA-N.
| Molecular formula | C13H8FN |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 2-fluoro-4-phenylbenzonitrile |
| InChIKey | GORYKZHNAWEFBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)C#N)F |
Computed by PubChem (NCBI)