cas: 872366-63-7 — see every product listed under this CAS number, including other names
3-Fluoro-2-nitrobenzaldehyde 97% (CAS 872366-63-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A823664-100mg |
| cas | 872366-63-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 1110.19 Pln | |
| Ambeed | 25g | 3719.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A823664 |
3-fluoro-2-nitrobenzaldehyde (CAS 872366-63-7) is a chemical compound with the molecular formula C7H4FNO3 and a molecular weight of 169.11 g/mol. IUPAC name: 3-fluoro-2-nitrobenzaldehyde. InChIKey: RJXDOIOYJGQGQH-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO3 |
|---|---|
| Molecular weight | 169.11 g/mol |
| IUPAC name | 3-fluoro-2-nitrobenzaldehyde |
| InChIKey | RJXDOIOYJGQGQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)