cas: 1029439-02-8 — see every product listed under this CAS number, including other names
3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 97% (CAS 1029439-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216216-100MG |
| cas | 1029439-02-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1101.71 Pln | |
| Fluorochem | 25g | 4407.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1029439-02-8) is a chemical compound with the molecular formula C12H16BFO3 and a molecular weight of 238.06 g/mol. IUPAC name: 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: ASYQJYIEVNXWDV-UHFFFAOYSA-N.
| Molecular formula | C12H16BFO3 |
|---|---|
| Molecular weight | 238.06 g/mol |
| IUPAC name | 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | ASYQJYIEVNXWDV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)O)F |
Computed by PubChem (NCBI)