cas: 850568-06-8 — see every product listed under this CAS number, including other names
3-Fluoro-4-hydrazinocarbonylphenylboronic acid (CAS 850568-06-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115PC7-1g |
| cas | 850568-06-8 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 534.80 Pln |
| delivery time | 3 weeks |
|---|
[3-fluoro-4-(hydrazinecarbonyl)phenyl]boronic acid (CAS 850568-06-8) is a chemical compound with the molecular formula C7H8BFN2O3 and a molecular weight of 197.96 g/mol. IUPAC name: [3-fluoro-4-(hydrazinecarbonyl)phenyl]boronic acid. InChIKey: HKIPNGLGNVCWCT-UHFFFAOYSA-N.
| Molecular formula | C7H8BFN2O3 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | [3-fluoro-4-(hydrazinecarbonyl)phenyl]boronic acid |
| InChIKey | HKIPNGLGNVCWCT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)NN)F)(O)O |
Computed by PubChem (NCBI)