3-Fluoro-4-iodoquinoline, 95%
cas: 213772-63-5 — see every product listed under this CAS number, including other names
3-Fluoro-4-iodoquinoline, 95% (CAS 213772-63-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 250mg, 1g, 5g, 50mg. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QK-5665-100mg |
| cas | 213772-63-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 500mg | price on request | |
| Ambeed | 100mg | 1610.81 Pln | |
| Ambeed | 250mg | 3168.31 Pln | |
| Ambeed | 1g | 7696.19 Pln | |
| Ambeed | 5g | 23260.06 Pln | |
| Chemat | 50mg | 784.40 Pln | |
| Chemat | 100mg | 1182.80 Pln | |
| Chemat | 250mg | 2310.80 Pln | |
| Chemat | 1g | 5603.60 Pln | |
| Chemat | 5g | 23402.00 Pln | |
| BLDpharm | 50mg | 1141.84 Pln | |
| BLDpharm | 100mg | 1730.53 Pln | |
| BLDpharm | 250mg | 3407.71 Pln | |
| BLDpharm | 1g | 8289.33 Pln | |
| BLDpharm | 5g | 25072.31 Pln | |
| Fluorochem | 50mg | 1455.76 Pln | |
| Fluorochem | 100mg | 2184.66 Pln | |
| Fluorochem | 250mg | 4277.68 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3-fluoro-4-iodoquinoline (CAS 213772-63-5) is a chemical compound with the molecular formula C9H5FIN and a molecular weight of 273.05 g/mol. IUPAC name: 3-fluoro-4-iodoquinoline. InChIKey: DITDYVZDDKBMGH-UHFFFAOYSA-N.
| Molecular formula | C9H5FIN |
|---|---|
| Molecular weight | 273.05 g/mol |
| IUPAC name | 3-fluoro-4-iodoquinoline |
| InChIKey | DITDYVZDDKBMGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C=N2)F)I |
Computed by PubChem (NCBI)