cas: 1415928-84-5 — see every product listed under this CAS number, including other names
3-Fluoro-5-(pyrrolidino)phenylboronic acid pinacol ester, 95% (CAS 1415928-84-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627776-100MG |
| cas | 1415928-84-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1112.13 Pln | |
| Fluorochem | 250mg | 1851.45 Pln | |
| Fluorochem | 1g | 4902.46 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine (CAS 1415928-84-5) is a chemical compound with the molecular formula C16H23BFNO2 and a molecular weight of 291.2 g/mol. IUPAC name: 1-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine. InChIKey: ZVMNXGFOCHXGCM-UHFFFAOYSA-N.
| Molecular formula | C16H23BFNO2 |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | 1-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine |
| InChIKey | ZVMNXGFOCHXGCM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)F)N3CCCC3 |
Computed by PubChem (NCBI)