3-Fluoropropyl 4-methylbenzenesulfonate, 95%
cas: 312-68-5 — see every product listed under this CAS number, including other names
3-Fluoropropyl 4-methylbenzenesulfonate, 95% (CAS 312-68-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F230061-250MG |
| cas | 312-68-5 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 242.64 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 638.33 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 626.25 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 362.00 Pln | |
| Chemat | 5g | 1115.60 Pln | |
| BLDpharm | 100mg | 169.96 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 308.80 Pln | |
| BLDpharm | 5g | 669.79 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3-fluoropropyl 4-methylbenzenesulfonate (CAS 312-68-5) is a chemical compound with the molecular formula C10H13FO3S and a molecular weight of 232.27 g/mol. IUPAC name: 3-fluoropropyl 4-methylbenzenesulfonate. InChIKey: PYCKJIAEKJWSKM-UHFFFAOYSA-N.
| Molecular formula | C10H13FO3S |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | 3-fluoropropyl 4-methylbenzenesulfonate |
| InChIKey | PYCKJIAEKJWSKM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCF |
Computed by PubChem (NCBI)
Synonyms:
3-Fluoroprop-1-yl toluene-4-sulphonate, 3-fluoropropyl 4-methylbenzenesulfonate, 3-Fluoropropyl p-toluenesulfonate, 3-Fluoro-1-propanol 1-tosylate, 3-fluoropropyl 4-methylbenzene-1-sulfonate, 3-Fluoropropyl p-toluenesulphonate, 3-Fluoropropyl 4-methylbe, fluoropropyl tosylate, 3-fluoropropyltosylate, 3-Fluoroprop-1-yl 4-methylbenzenesulphonate