CAS 4481-27-0 appears in our catalog under these names: 3-Formyl-5-methylbenzoic acid, 96%, 3-Formyl-5-methylbenzoic Acid, 3-Formyl-5-methylbenzoic acid, 98%, 3-Formyl-5-methylbenzoic acid, ≥95%, ≥95%, 3-Formyl-5-methylbenzoic acid, ≥95%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 5g, 100mg, 10g, 2g, 25g.
3-formyl-5-methylbenzoic acid (CAS 4481-27-0) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 3-formyl-5-methylbenzoic acid. InChIKey: SFULMLBWHKPCAF-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 3-formyl-5-methylbenzoic acid |
| InChIKey | SFULMLBWHKPCAF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)O)C=O |
Computed by PubChem (NCBI)