cas: 91136-43-5 — see every product listed under this CAS number, including other names
3-Hydroxy-1-naphthaldehyde, ≥97-<99% (CAS 91136-43-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1354-97-99-1g |
| cas | 91136-43-5 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 4033.92 Pln | |
| Hoffman Fine Chemicals | 2,5g | 6605.06 Pln | |
| Hoffman Fine Chemicals | 5g | 11090.20 Pln | |
| Hoffman Fine Chemicals | 10g | 17553.14 Pln | |
| Hoffman Fine Chemicals | 25g | 34791.90 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
3-hydroxynaphthalene-1-carbaldehyde (CAS 91136-43-5) is a chemical compound with the molecular formula C11H8O2 and a molecular weight of 172.18 g/mol. IUPAC name: 3-hydroxynaphthalene-1-carbaldehyde. InChIKey: PLCQXZXTFCITAJ-UHFFFAOYSA-N.
| Molecular formula | C11H8O2 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 3-hydroxynaphthalene-1-carbaldehyde |
| InChIKey | PLCQXZXTFCITAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2C=O)O |
Computed by PubChem (NCBI)