cas: 20759-40-4 — see every product listed under this CAS number, including other names
3-Hydroxybenzenesulfonamide 95+% (CAS 20759-40-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A196561-100mg |
| cas | 20759-40-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1683.12 Pln | |
| Ambeed | 250mg | 3474.25 Pln | |
| Ambeed | 1g | 8513.88 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A196561 |
3-hydroxybenzenesulfonamide (CAS 20759-40-4) is a chemical compound with the molecular formula C6H7NO3S and a molecular weight of 173.19 g/mol. IUPAC name: 3-hydroxybenzenesulfonamide. InChIKey: OQPPWRYNXRWUAQ-UHFFFAOYSA-N.
| Molecular formula | C6H7NO3S |
|---|---|
| Molecular weight | 173.19 g/mol |
| IUPAC name | 3-hydroxybenzenesulfonamide |
| InChIKey | OQPPWRYNXRWUAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)O |
Computed by PubChem (NCBI)