cas: 37418-88-5 — see every product listed under this CAS number, including other names
3-Hydroxyphthalic anhydride 97% (CAS 37418-88-5) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A247195-1000g |
| cas | 37418-88-5 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 14271.06 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 515.00 Pln | |
| Ambeed | 100g | 1844.44 Pln | |
| Ambeed | 500g | 8942.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A247195 |
4-hydroxy-2-benzofuran-1,3-dione (CAS 37418-88-5) is a chemical compound with the molecular formula C8H4O4 and a molecular weight of 164.11 g/mol. IUPAC name: 4-hydroxy-2-benzofuran-1,3-dione. InChIKey: CCTOEAMRIIXGDJ-UHFFFAOYSA-N.
| Molecular formula | C8H4O4 |
|---|---|
| Molecular weight | 164.11 g/mol |
| IUPAC name | 4-hydroxy-2-benzofuran-1,3-dione |
| InChIKey | CCTOEAMRIIXGDJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)OC2=O |
Computed by PubChem (NCBI)