cas: 956485-59-9 — see every product listed under this CAS number, including other names
3-Iodo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile (CAS 956485-59-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F604281-100MG |
| cas | 956485-59-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 763.29 Pln | |
| Fluorochem | 250mg | 1101.71 Pln | |
| Fluorochem | 500mg | 1788.97 Pln | |
| Fluorochem | 1g | 2700.11 Pln |
| delivery time | 3-4 weeks |
|---|
3-iodo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile (CAS 956485-59-9) is a chemical compound with the molecular formula C8H4IN3 and a molecular weight of 269.04 g/mol. IUPAC name: 3-iodo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile. InChIKey: ISSYSBAEUNYLCG-UHFFFAOYSA-N.
| Molecular formula | C8H4IN3 |
|---|---|
| Molecular weight | 269.04 g/mol |
| IUPAC name | 3-iodo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile |
| InChIKey | ISSYSBAEUNYLCG-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1C#N)C(=CN2)I |
Computed by PubChem (NCBI)