cas: 1365969-58-9 — see every product listed under this CAS number, including other names
3-Iodo-4-(trifluoromethoxy)aniline, 97%, 97% (CAS 1365969-58-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HUO1-100mg |
| cas | 1365969-58-9 |
| size | 100mg |
| availability | 18g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 746.00 Pln | |
| Chemat | 5g | 1898.00 Pln | |
| Chemat | 10g | 2262.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-iodo-4-(trifluoromethoxy)aniline (CAS 1365969-58-9) is a chemical compound with the molecular formula C7H5F3INO and a molecular weight of 303.02 g/mol. IUPAC name: 3-iodo-4-(trifluoromethoxy)aniline. InChIKey: VKATTYNFWRWDDN-UHFFFAOYSA-N.
| Molecular formula | C7H5F3INO |
|---|---|
| Molecular weight | 303.02 g/mol |
| IUPAC name | 3-iodo-4-(trifluoromethoxy)aniline |
| InChIKey | VKATTYNFWRWDDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)I)OC(F)(F)F |
Computed by PubChem (NCBI)